C32H69N5 — CID 19089570
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;octan-1-amine (PubChem CID 19089570) has the molecular formula C32H69N5 and a molecular weight of 523.94 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;octan-1-amine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;octan-1-amine |
|---|---|
| PubChem CID | 19089570 |
| Molecular Formula | C32H69N5 |
| Molecular Weight | 523.94 g/mol |
| Exact Mass | 523.56 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;octan-1-amine |
| SMILES | CC1(C)CC(NCCCCCCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.CCCCCCCCN |
| InChI | InChI=1S/C24H50N4.C8H19N/c1-21(2)15-19(16-22(3,4)27-21)25-13-11-9-10-12-14-26-20-17-23(5,6)28-24(7,8)18-20;1-2-3-4-5-6-7-8-9/h19-20,25-28H,9-18H2,1-8H3;2-9H2,1H3 |
| InChIKey | QJRUVPDVHPIUQJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.94 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|