C11H6ClNO3 — CID 19090071
6-chloro-3,4-dihydrofuro[3,4-b]quinoline-1,9-dione (PubChem CID 19090071) has the molecular formula C11H6ClNO3 and a molecular weight of 235.63 g/mol. Its IUPAC name is 6-chloro-3,4-dihydrofuro[3,4-b]quinoline-1,9-dione.
| Compound Name | 6-chloro-3,4-dihydrofuro[3,4-b]quinoline-1,9-dione |
|---|---|
| PubChem CID | 19090071 |
| Molecular Formula | C11H6ClNO3 |
| Molecular Weight | 235.63 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 6-chloro-3,4-dihydrofuro[3,4-b]quinoline-1,9-dione |
| SMILES | O=C1OCc2[nH]c3cc(Cl)ccc3c(=O)c21 |
| InChI | InChI=1S/C11H6ClNO3/c12-5-1-2-6-7(3-5)13-8-4-16-11(15)9(8)10(6)14/h1-3H,4H2,(H,13,14) |
| InChIKey | SBHSOCAGGSRBLG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |