About 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide
3-(bromomethyl)-N,N-dimethylaniline;hydrobromide (PubChem CID 19090139) has the molecular formula C9H13Br2N
and a molecular weight of 295.02 g/mol. Its IUPAC name is 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide.
Molecular Properties
| Compound Name | 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide |
| PubChem CID | 19090139 |
| Molecular Formula | C9H13Br2N |
| Molecular Weight | 295.02 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide |
| SMILES | Br.CN(C)c1cccc(CBr)c1 |
| InChI | InChI=1S/C9H12BrN.BrH/c1-11(2)9-5-3-4-8(6-9)7-10;/h3-6H,7H2,1-2H3;1H |
| InChIKey | PWEOIOHVEOBPNV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.02 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide?
The IUPAC name of 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide (CID 19090139) is 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide.
What is the SMILES notation for 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide?
The canonical SMILES for 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide is Br.CN(C)c1cccc(CBr)c1.
What is the InChIKey of 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide?
The InChIKey is PWEOIOHVEOBPNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN.BrH/c1-11(2)9-5-3-4-8(6-9)7-10;/h3-6H,7H2,1-2H3;1H.
What are the key properties of 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide?
3-(bromomethyl)-N,N-dimethylaniline;hydrobromide has a molecular weight of 295.02 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-N,N-dimethylaniline;hydrobromide is sourced from PubChem (CID 19090139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).