C42H74N8O3 — CID 19090183
2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-6-isocyanato-1,3,5-triazine-2,4-diamine (PubChem CID 19090183) has the molecular formula C42H74N8O3 and a molecular weight of 739.11 g/mol. Its IUPAC name is 2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-6-isocyanato-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-6-isocyanato-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19090183 |
| Molecular Formula | C42H74N8O3 |
| Molecular Weight | 739.11 g/mol |
| Exact Mass | 738.59 |
| IUPAC Name | 2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-6-isocyanato-1,3,5-triazine-2,4-diamine |
| SMILES | CCCC(Nc1nc(N=C=O)nc(NC(CCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C42H74N8O3/c1-11-19-34(30-25-39(3,4)49(40(5,6)26-30)52-32-21-15-13-16-22-32)44-37-46-36(43-29-51)47-38(48-37)45-35(20-12-2)31-27-41(7,8)50(42(9,10)28-31)53-33-23-17-14-18-24-33/h30-35H,11-28H2,1-10H3,(H2,44,45,46,47,48) |
| InChIKey | VDCSPIWLIUBJLX-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.11 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|