C52H102N8O4 — CID 19090185
3-[3-[[4,6-bis[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]propoxy]butan-2-ol (PubChem CID 19090185) has the molecular formula C52H102N8O4 and a molecular weight of 903.44 g/mol. Its IUPAC name is 3-[3-[[4,6-bis[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]propoxy]butan-2-ol.
| Compound Name | 3-[3-[[4,6-bis[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]propoxy]butan-2-ol |
|---|---|
| PubChem CID | 19090185 |
| Molecular Formula | C52H102N8O4 |
| Molecular Weight | 903.44 g/mol |
| Exact Mass | 902.80 |
| IUPAC Name | 3-[3-[[4,6-bis[4-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butylamino]-1,3,5-triazin-2-yl]amino]propoxy]butan-2-ol |
| SMILES | CCCCCCCCON1C(C)(C)CC(CCCCNc2nc(NCCCCC3CC(C)(C)N(OCCCCCCCC)C(C)(C)C3)nc(NCCCOC(C)C(C)O)n2)CC1(C)C |
| InChI | InChI=1S/C52H102N8O4/c1-13-15-17-19-21-27-36-63-59-49(5,6)38-44(39-50(59,7)8)30-23-25-32-53-46-56-47(58-48(57-46)55-34-29-35-62-43(4)42(3)61)54-33-26-24-31-45-40-51(9,10)60(52(11,12)41-45)64-37-28-22-20-18-16-14-2/h42-45,61H,13-41H2,1-12H3,(H3,53,54,55,56,57,58) |
| InChIKey | ARIFVNVLAISHSO-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.44 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|