C41H76N8O2 — CID 19090189
2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 19090189) has the molecular formula C41H76N8O2 and a molecular weight of 713.11 g/mol. Its IUPAC name is 2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19090189 |
| Molecular Formula | C41H76N8O2 |
| Molecular Weight | 713.11 g/mol |
| Exact Mass | 712.61 |
| IUPAC Name | 2-N,4-N-bis[1-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCC(Nc1nc(N)nc(NC(CCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C41H76N8O2/c1-11-19-33(29-25-38(3,4)48(39(5,6)26-29)50-31-21-15-13-16-22-31)43-36-45-35(42)46-37(47-36)44-34(20-12-2)30-27-40(7,8)49(41(9,10)28-30)51-32-23-17-14-18-24-32/h29-34H,11-28H2,1-10H3,(H4,42,43,44,45,46,47) |
| InChIKey | VAHNHTBJDHOGJL-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.11 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |