C49H96N8O4 — CID 19090190
2-N,2-N-bis(methoxymethyl)-4-N,6-N-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 19090190) has the molecular formula C49H96N8O4 and a molecular weight of 861.36 g/mol. Its IUPAC name is 2-N,2-N-bis(methoxymethyl)-4-N,6-N-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-bis(methoxymethyl)-4-N,6-N-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19090190 |
| Molecular Formula | C49H96N8O4 |
| Molecular Weight | 861.36 g/mol |
| Exact Mass | 860.76 |
| IUPAC Name | 2-N,2-N-bis(methoxymethyl)-4-N,6-N-bis[1-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCCCON1C(C)(C)CC(C(CCC)Nc2nc(NC(CCC)C3CC(C)(C)N(OCCCCCCCC)C(C)(C)C3)nc(N(COC)COC)n2)CC1(C)C |
| InChI | InChI=1S/C49H96N8O4/c1-15-19-21-23-25-27-31-60-56-46(5,6)33-39(34-47(56,7)8)41(29-17-3)50-43-52-44(54-45(53-43)55(37-58-13)38-59-14)51-42(30-18-4)40-35-48(9,10)57(49(11,12)36-40)61-32-28-26-24-22-20-16-2/h39-42H,15-38H2,1-14H3,(H2,50,51,52,53,54) |
| InChIKey | CTWDGYRRKZOVFX-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.36 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|