C33H58ClN7O2 — CID 19090191
6-chloro-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 19090191) has the molecular formula C33H58ClN7O2 and a molecular weight of 620.33 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19090191 |
| Molecular Formula | C33H58ClN7O2 |
| Molecular Weight | 620.33 g/mol |
| Exact Mass | 619.43 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(Nc2nc(Cl)nc(NC3CC(C)(C)N(OC4CCCCC4)C(C)(C)C3)n2)CC(C)(C)N1OC1CCCCC1 |
| InChI | InChI=1S/C33H58ClN7O2/c1-30(2)19-23(20-31(3,4)40(30)42-25-15-11-9-12-16-25)35-28-37-27(34)38-29(39-28)36-24-21-32(5,6)41(33(7,8)22-24)43-26-17-13-10-14-18-26/h23-26H,9-22H2,1-8H3,(H2,35,36,37,38,39) |
| InChIKey | BBLYVXBNXJIIRX-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.33 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |