C12H24N2 — CID 19090272
2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-amine (PubChem CID 19090272) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 19090272 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCN1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C12H24N2/c1-6-7-14-11(2,3)8-10(13)9-12(14,4)5/h6,10H,1,7-9,13H2,2-5H3 |
| InChIKey | ICEGUAZGNKNIDO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|