C17H18N2O4S — CID 19090405
oxalic acid;2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepine (PubChem CID 19090405) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is oxalic acid;2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepine.
| Compound Name | oxalic acid;2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 19090405 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | oxalic acid;2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepine |
| SMILES | C(=C/c1nc2c(s1)NCCCC2)\c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H16N2S.C2H2O4/c1-2-6-12(7-3-1)9-10-14-17-13-8-4-5-11-16-15(13)18-14;3-1(4)2(5)6/h1-3,6-7,9-10,16H,4-5,8,11H2;(H,3,4)(H,5,6)/b10-9+; |
| InChIKey | DUFWVDYQBDQKRN-RRABGKBLSA-N |
| XLogP | 3.22 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|