C16H16F2N2S — CID 19090449
2-(2,6-difluorophenyl)-4-prop-2-enyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]azepine (PubChem CID 19090449) has the molecular formula C16H16F2N2S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-prop-2-enyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]azepine.
| Compound Name | 2-(2,6-difluorophenyl)-4-prop-2-enyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 19090449 |
| Molecular Formula | C16H16F2N2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-prop-2-enyl-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]azepine |
| SMILES | C=CCN1CCCCc2nc(-c3c(F)cccc3F)sc21 |
| InChI | InChI=1S/C16H16F2N2S/c1-2-9-20-10-4-3-8-13-16(20)21-15(19-13)14-11(17)6-5-7-12(14)18/h2,5-7H,1,3-4,8-10H2 |
| InChIKey | DLXVSCXVUKREGQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|