C21H32N2O4 — CID 19090578
[1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzoate (PubChem CID 19090578) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is [1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzoate.
| Compound Name | [1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 19090578 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [1-(butylcarbamoyloxy)-2,2,6,6-tetramethylpiperidin-4-yl] benzoate |
| SMILES | CCCCNC(=O)ON1C(C)(C)CC(OC(=O)c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C21H32N2O4/c1-6-7-13-22-19(25)27-23-20(2,3)14-17(15-21(23,4)5)26-18(24)16-11-9-8-10-12-16/h8-12,17H,6-7,13-15H2,1-5H3,(H,22,25) |
| InChIKey | ORVPAHHOJBMKDY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|