About 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione
8,9-dichloro-6,11-dihydroxytetracene-5,12-dione (PubChem CID 19090660) has the molecular formula C18H8Cl2O4
and a molecular weight of 359.16 g/mol. Its IUPAC name is 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione.
Molecular Properties
| Compound Name | 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione |
| PubChem CID | 19090660 |
| Molecular Formula | C18H8Cl2O4 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(O)c1cc(Cl)c(Cl)cc1c2O |
| InChI | InChI=1S/C18H8Cl2O4/c19-11-5-9-10(6-12(11)20)18(24)14-13(17(9)23)15(21)7-3-1-2-4-8(7)16(14)22/h1-6,23-24H |
| InChIKey | KIMSDKWAOVUAET-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione?
The IUPAC name of 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione (CID 19090660) is 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione.
What is the SMILES notation for 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione?
The canonical SMILES for 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione is O=C1c2ccccc2C(=O)c2c1c(O)c1cc(Cl)c(Cl)cc1c2O.
What is the InChIKey of 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione?
The InChIKey is KIMSDKWAOVUAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8Cl2O4/c19-11-5-9-10(6-12(11)20)18(24)14-13(17(9)23)15(21)7-3-1-2-4-8(7)16(14)22/h1-6,23-24H.
What are the key properties of 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione?
8,9-dichloro-6,11-dihydroxytetracene-5,12-dione has a molecular weight of 359.16 g/mol, XLogP of 4.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dichloro-6,11-dihydroxytetracene-5,12-dione is sourced from PubChem (CID 19090660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).