C14H26O4 — CID 19090996
2,2,5,5-tetraethylhexanedioic acid (PubChem CID 19090996) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,2,5,5-tetraethylhexanedioic acid.
| Compound Name | 2,2,5,5-tetraethylhexanedioic acid |
|---|---|
| PubChem CID | 19090996 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2,2,5,5-tetraethylhexanedioic acid |
| SMILES | CCC(CC)(CCC(CC)(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26O4/c1-5-13(6-2,11(15)16)9-10-14(7-3,8-4)12(17)18/h5-10H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | BWBOGFZTAUZLAP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |