About 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid
2-ethyl-2,5-dimethyl-5-propylhexanedioic acid (PubChem CID 19091011) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid.
Molecular Properties
| Compound Name | 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid |
| PubChem CID | 19091011 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid |
| SMILES | CCCC(C)(CCC(C)(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H24O4/c1-5-7-13(4,11(16)17)9-8-12(3,6-2)10(14)15/h5-9H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | BLCVTHXXJUUYIC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid?
The IUPAC name of 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid (CID 19091011) is 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid.
What is the SMILES notation for 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid?
The canonical SMILES for 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid is CCCC(C)(CCC(C)(CC)C(=O)O)C(=O)O.
What is the InChIKey of 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid?
The InChIKey is BLCVTHXXJUUYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-5-7-13(4,11(16)17)9-8-12(3,6-2)10(14)15/h5-9H2,1-4H3,(H,14,15)(H,16,17).
What are the key properties of 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid?
2-ethyl-2,5-dimethyl-5-propylhexanedioic acid has a molecular weight of 244.33 g/mol, XLogP of 3.16, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,5-dimethyl-5-propylhexanedioic acid is sourced from PubChem (CID 19091011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).