About 2,2-dimethyl-5,5-dipropylhexanedioic acid
2,2-dimethyl-5,5-dipropylhexanedioic acid (PubChem CID 19091018) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,2-dimethyl-5,5-dipropylhexanedioic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-5,5-dipropylhexanedioic acid |
| PubChem CID | 19091018 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2,2-dimethyl-5,5-dipropylhexanedioic acid |
| SMILES | CCCC(CCC)(CCC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26O4/c1-5-7-14(8-6-2,12(17)18)10-9-13(3,4)11(15)16/h5-10H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | ZIPYNNFBHLDWKO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-5,5-dipropylhexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5,5-dipropylhexanedioic acid?
The IUPAC name of 2,2-dimethyl-5,5-dipropylhexanedioic acid (CID 19091018) is 2,2-dimethyl-5,5-dipropylhexanedioic acid.
What is the SMILES notation for 2,2-dimethyl-5,5-dipropylhexanedioic acid?
The canonical SMILES for 2,2-dimethyl-5,5-dipropylhexanedioic acid is CCCC(CCC)(CCC(C)(C)C(=O)O)C(=O)O.
What is the InChIKey of 2,2-dimethyl-5,5-dipropylhexanedioic acid?
The InChIKey is ZIPYNNFBHLDWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-5-7-14(8-6-2,12(17)18)10-9-13(3,4)11(15)16/h5-10H2,1-4H3,(H,15,16)(H,17,18).
What are the key properties of 2,2-dimethyl-5,5-dipropylhexanedioic acid?
2,2-dimethyl-5,5-dipropylhexanedioic acid has a molecular weight of 258.36 g/mol, XLogP of 3.55, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5,5-dipropylhexanedioic acid is sourced from PubChem (CID 19091018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).