C6H7F7 — CID 19091132
1,1,1,2,2,3,3-heptafluorohexane (PubChem CID 19091132) has the molecular formula C6H7F7 and a molecular weight of 212.11 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluorohexane.
| Compound Name | 1,1,1,2,2,3,3-heptafluorohexane |
|---|---|
| PubChem CID | 19091132 |
| Molecular Formula | C6H7F7 |
| Molecular Weight | 212.11 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluorohexane |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7/c1-2-3-4(7,8)5(9,10)6(11,12)13/h2-3H2,1H3 |
| InChIKey | XMEPUXUKDYDDDY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.11 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|