C6H5F9 — CID 19091136
1,1,1-trifluoro-2,2-bis(trifluoromethyl)butane (PubChem CID 19091136) has the molecular formula C6H5F9 and a molecular weight of 248.09 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,2-bis(trifluoromethyl)butane.
| Compound Name | 1,1,1-trifluoro-2,2-bis(trifluoromethyl)butane |
|---|---|
| PubChem CID | 19091136 |
| Molecular Formula | C6H5F9 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1,1,1-trifluoro-2,2-bis(trifluoromethyl)butane |
| SMILES | CCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9/c1-2-3(4(7,8)9,5(10,11)12)6(13,14)15/h2H2,1H3 |
| InChIKey | AALPAEKQSYKXPJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |