About 3-methylidenepentane-2,4-diol
3-methylidenepentane-2,4-diol (PubChem CID 19091709) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 3-methylidenepentane-2,4-diol.
Molecular Properties
| Compound Name | 3-methylidenepentane-2,4-diol |
| PubChem CID | 19091709 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 3-methylidenepentane-2,4-diol |
| SMILES | C=C(C(C)O)C(C)O |
| InChI | InChI=1S/C6H12O2/c1-4(5(2)7)6(3)8/h5-8H,1H2,2-3H3 |
| InChIKey | GSTHQNTUGGGKIR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenepentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenepentane-2,4-diol?
The IUPAC name of 3-methylidenepentane-2,4-diol (CID 19091709) is 3-methylidenepentane-2,4-diol.
What is the SMILES notation for 3-methylidenepentane-2,4-diol?
The canonical SMILES for 3-methylidenepentane-2,4-diol is C=C(C(C)O)C(C)O.
What is the InChIKey of 3-methylidenepentane-2,4-diol?
The InChIKey is GSTHQNTUGGGKIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-4(5(2)7)6(3)8/h5-8H,1H2,2-3H3.
What are the key properties of 3-methylidenepentane-2,4-diol?
3-methylidenepentane-2,4-diol has a molecular weight of 116.16 g/mol, XLogP of 0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenepentane-2,4-diol is sourced from PubChem (CID 19091709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).