C24H28N4O8 — CID 19092266
(E)-but-2-enedioic acid;N-methyl-N-[(4-nitrophenyl)methyl]-1-[1-(4-nitrophenyl)piperidin-4-yl]methanamine (PubChem CID 19092266) has the molecular formula C24H28N4O8 and a molecular weight of 500.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-methyl-N-[(4-nitrophenyl)methyl]-1-[1-(4-nitrophenyl)piperidin-4-yl]methanamine.
| Compound Name | (E)-but-2-enedioic acid;N-methyl-N-[(4-nitrophenyl)methyl]-1-[1-(4-nitrophenyl)piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 19092266 |
| Molecular Formula | C24H28N4O8 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (E)-but-2-enedioic acid;N-methyl-N-[(4-nitrophenyl)methyl]-1-[1-(4-nitrophenyl)piperidin-4-yl]methanamine |
| SMILES | CN(Cc1ccc([N+](=O)[O-])cc1)CC1CCN(c2ccc([N+](=O)[O-])cc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24N4O4.C4H4O4/c1-21(14-16-2-4-19(5-3-16)23(25)26)15-17-10-12-22(13-11-17)18-6-8-20(9-7-18)24(27)28;5-3(6)1-2-4(7)8/h2-9,17H,10-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CLKJNFOBHIEFGI-WLHGVMLRSA-N |
| XLogP | 3.56 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|