About benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate
benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 19094446) has the molecular formula C18H17FO3
and a molecular weight of 300.33 g/mol. Its IUPAC name is benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate |
| PubChem CID | 19094446 |
| Molecular Formula | C18H17FO3 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CC1CC(C(=O)OCc2ccccc2)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C18H17FO3/c1-12-9-16(15-8-7-14(19)10-17(15)22-12)18(20)21-11-13-5-3-2-4-6-13/h2-8,10,12,16H,9,11H2,1H3 |
| InChIKey | OUZKHCWNBGAXGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate?
The IUPAC name of benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate (CID 19094446) is benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate.
What is the SMILES notation for benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate?
The canonical SMILES for benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate is CC1CC(C(=O)OCc2ccccc2)c2ccc(F)cc2O1.
What is the InChIKey of benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate?
The InChIKey is OUZKHCWNBGAXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FO3/c1-12-9-16(15-8-7-14(19)10-17(15)22-12)18(20)21-11-13-5-3-2-4-6-13/h2-8,10,12,16H,9,11H2,1H3.
What are the key properties of benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate?
benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate has a molecular weight of 300.33 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 7-fluoro-2-methyl-3,4-dihydro-2H-chromene-4-carboxylate is sourced from PubChem (CID 19094446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).