C22H43N3O8 — CID 19095095
acetic acid;azane;N-ethyl-1-phenylcyclohexan-1-amine (PubChem CID 19095095) has the molecular formula C22H43N3O8 and a molecular weight of 477.60 g/mol. Its IUPAC name is acetic acid;azane;N-ethyl-1-phenylcyclohexan-1-amine.
| Compound Name | acetic acid;azane;N-ethyl-1-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 19095095 |
| Molecular Formula | C22H43N3O8 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | acetic acid;azane;N-ethyl-1-phenylcyclohexan-1-amine |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CCNC1(c2ccccc2)CCCCC1.N.N |
| InChI | InChI=1S/C14H21N.4C2H4O2.2H3N/c1-2-15-14(11-7-4-8-12-14)13-9-5-3-6-10-13;4*1-2(3)4;;/h3,5-6,9-10,15H,2,4,7-8,11-12H2,1H3;4*1H3,(H,3,4);2*1H3 |
| InChIKey | CKKFADKXVFSDHD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 231.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |