C15H16N2 — CID 19095338
1,7-dimethyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine (PubChem CID 19095338) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 1,7-dimethyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine.
| Compound Name | 1,7-dimethyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 19095338 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1,7-dimethyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine |
| SMILES | CC1=NCCn2c1cc(C)c2-c1ccccc1 |
| InChI | InChI=1S/C15H16N2/c1-11-10-14-12(2)16-8-9-17(14)15(11)13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | BOECSSSOXHDAQO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |