C19H22N2O4 — CID 19095364
(E)-but-2-enedioic acid;1,7-dimethyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 19095364) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1,7-dimethyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
| Compound Name | (E)-but-2-enedioic acid;1,7-dimethyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 19095364 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (E)-but-2-enedioic acid;1,7-dimethyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
| SMILES | Cc1cc2n(c1-c1ccccc1)CCNC2C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H18N2.C4H4O4/c1-11-10-14-12(2)16-8-9-17(14)15(11)13-6-4-3-5-7-13;5-3(6)1-2-4(7)8/h3-7,10,12,16H,8-9H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | DNHLQYWFZSXSGD-WLHGVMLRSA-N |
| XLogP | 2.84 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|