About 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione
2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione (PubChem CID 19095456) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione.
Molecular Properties
| Compound Name | 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione |
| PubChem CID | 19095456 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione |
| SMILES | CCN1C(=S)C=C(N)NC1N |
| InChI | InChI=1S/C6H12N4S/c1-2-10-5(11)3-4(7)9-6(10)8/h3,6,9H,2,7-8H2,1H3 |
| InChIKey | YSOWLUFLYXBKTR-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione?
The IUPAC name of 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione (CID 19095456) is 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione.
What is the SMILES notation for 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione?
The canonical SMILES for 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione is CCN1C(=S)C=C(N)NC1N.
What is the InChIKey of 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione?
The InChIKey is YSOWLUFLYXBKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-2-10-5(11)3-4(7)9-6(10)8/h3,6,9H,2,7-8H2,1H3.
What are the key properties of 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione?
2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione has a molecular weight of 172.26 g/mol, XLogP of -0.72, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-3-ethyl-1,2-dihydropyrimidine-4-thione is sourced from PubChem (CID 19095456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).