About 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one
6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 19096634) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one |
| PubChem CID | 19096634 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(CC(O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C9H13N3O4/c1-9(2)15-7(4-8(14)16-9)3-6(13)5-11-12-10/h4,6,13H,3,5H2,1-2H3 |
| InChIKey | FTGYYKSOCSFVFL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
The IUPAC name of 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one (CID 19096634) is 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
The canonical SMILES for 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one is CC1(C)OC(=O)C=C(CC(O)CN=[N+]=[N-])O1.
What is the InChIKey of 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
The InChIKey is FTGYYKSOCSFVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-9(2)15-7(4-8(14)16-9)3-6(13)5-11-12-10/h4,6,13H,3,5H2,1-2H3.
What are the key properties of 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one?
6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one has a molecular weight of 227.22 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-azido-2-hydroxypropyl)-2,2-dimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 19096634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).