C22H42O3Si2 — CID 19096694
6,10-bis[[tert-butyl(dimethyl)silyl]oxy]deca-1,3-diyn-5-ol (PubChem CID 19096694) has the molecular formula C22H42O3Si2 and a molecular weight of 410.75 g/mol. Its IUPAC name is 6,10-bis[[tert-butyl(dimethyl)silyl]oxy]deca-1,3-diyn-5-ol.
| Compound Name | 6,10-bis[[tert-butyl(dimethyl)silyl]oxy]deca-1,3-diyn-5-ol |
|---|---|
| PubChem CID | 19096694 |
| Molecular Formula | C22H42O3Si2 |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 6,10-bis[[tert-butyl(dimethyl)silyl]oxy]deca-1,3-diyn-5-ol |
| SMILES | C#CC#CC(O)C(CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O3Si2/c1-12-13-16-19(23)20(25-27(10,11)22(5,6)7)17-14-15-18-24-26(8,9)21(2,3)4/h1,19-20,23H,14-15,17-18H2,2-11H3 |
| InChIKey | KOMJDQVAIIYZNW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|