C13H11F13O2 — CID 19097005
5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]heptane-2,3-diol (PubChem CID 19097005) has the molecular formula C13H11F13O2 and a molecular weight of 446.20 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 19097005 |
| Molecular Formula | C13H11F13O2 |
| Molecular Weight | 446.20 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)bicyclo[2.2.1]heptane-2,3-diol |
| SMILES | OC1C2CC(C1O)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C2 |
| InChI | InChI=1S/C13H11F13O2/c14-8(15,5-2-3-1-4(5)7(28)6(3)27)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h3-7,27-28H,1-2H2 |
| InChIKey | DNHGXHBRCYRAEI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|