C15H11F17O2 — CID 19097007
5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctyl)bicyclo[2.2.1]heptane-2,3-diol (PubChem CID 19097007) has the molecular formula C15H11F17O2 and a molecular weight of 546.22 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)bicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctyl)bicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 19097007 |
| Molecular Formula | C15H11F17O2 |
| Molecular Weight | 546.22 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)bicyclo[2.2.1]heptane-2,3-diol |
| SMILES | C1C2CC(C1C(C2O)O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChI | InChI=1S/C15H11F17O2/c16-8(17,5-2-3-1-4(5)7(34)6(3)33)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h3-7,33-34H,1-2H2 |
| InChIKey | KKAUOARAVFIKJO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | 788 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.22 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|