C20H26N4O3 — CID 19097300
N-[4-amino-2,6-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 19097300) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[4-amino-2,6-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | N-[4-amino-2,6-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 19097300 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[4-amino-2,6-dioxo-1,3-bis(prop-2-enyl)pyrimidin-5-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | C=CCn1c(N)c(NC(=O)C23CC4CC(CC2C4)C3)c(=O)n(CC=C)c1=O |
| InChI | InChI=1S/C20H26N4O3/c1-3-5-23-16(21)15(17(25)24(6-4-2)19(23)27)22-18(26)20-10-12-7-13(11-20)9-14(20)8-12/h3-4,12-14H,1-2,5-11,21H2,(H,22,26) |
| InChIKey | FSPDBLAOOICCDB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|