C10H19N3S — CID 19097464
(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea (PubChem CID 19097464) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea.
| Compound Name | (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea |
|---|---|
| PubChem CID | 19097464 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)thiourea |
| SMILES | CN1C2CCCC1CC(NC(N)=S)C2 |
| InChI | InChI=1S/C10H19N3S/c1-13-8-3-2-4-9(13)6-7(5-8)12-10(11)14/h7-9H,2-6H2,1H3,(H3,11,12,14) |
| InChIKey | XLCJYPJGNOTKPF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|