About 6-aminohexane-1,3-diol
6-aminohexane-1,3-diol (PubChem CID 19097730) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is 6-aminohexane-1,3-diol.
Molecular Properties
| Compound Name | 6-aminohexane-1,3-diol |
| PubChem CID | 19097730 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 6-aminohexane-1,3-diol |
| SMILES | NCCCC(O)CCO |
| InChI | InChI=1S/C6H15NO2/c7-4-1-2-6(9)3-5-8/h6,8-9H,1-5,7H2 |
| InChIKey | KMFLAJUZPNTNRG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-aminohexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminohexane-1,3-diol?
The IUPAC name of 6-aminohexane-1,3-diol (CID 19097730) is 6-aminohexane-1,3-diol.
What is the SMILES notation for 6-aminohexane-1,3-diol?
The canonical SMILES for 6-aminohexane-1,3-diol is NCCCC(O)CCO.
What is the InChIKey of 6-aminohexane-1,3-diol?
The InChIKey is KMFLAJUZPNTNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2/c7-4-1-2-6(9)3-5-8/h6,8-9H,1-5,7H2.
What are the key properties of 6-aminohexane-1,3-diol?
6-aminohexane-1,3-diol has a molecular weight of 133.19 g/mol, XLogP of -0.53, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminohexane-1,3-diol is sourced from PubChem (CID 19097730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).