C7H11N7O — CID 19098004
N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methyl]prop-2-enamide (PubChem CID 19098004) has the molecular formula C7H11N7O and a molecular weight of 209.21 g/mol. Its IUPAC name is N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methyl]prop-2-enamide.
| Compound Name | N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 19098004 |
| Molecular Formula | C7H11N7O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-[[(4,6-diamino-1,3,5-triazin-2-yl)amino]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H11N7O/c1-2-4(15)10-3-11-7-13-5(8)12-6(9)14-7/h2H,1,3H2,(H,10,15)(H5,8,9,11,12,13,14) |
| InChIKey | FBPYEQJZNXUKBO-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|