About 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol
2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol (PubChem CID 19098019) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol |
| PubChem CID | 19098019 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol |
| SMILES | CC(C)(c1cc(O)c(N)c(O)c1)c1cc(O)c(N)c(O)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,7-3-9(18)13(16)10(19)4-7)8-5-11(20)14(17)12(21)6-8/h3-6,18-21H,16-17H2,1-2H3 |
| InChIKey | KMRSKQBWWLOPHW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol?
The IUPAC name of 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol (CID 19098019) is 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol.
What is the SMILES notation for 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol?
The canonical SMILES for 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol is CC(C)(c1cc(O)c(N)c(O)c1)c1cc(O)c(N)c(O)c1.
What is the InChIKey of 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol?
The InChIKey is KMRSKQBWWLOPHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4/c1-15(2,7-3-9(18)13(16)10(19)4-7)8-5-11(20)14(17)12(21)6-8/h3-6,18-21H,16-17H2,1-2H3.
What are the key properties of 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol?
2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol has a molecular weight of 290.32 g/mol, XLogP of 2.00, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[2-(4-amino-3,5-dihydroxyphenyl)propan-2-yl]benzene-1,3-diol is sourced from PubChem (CID 19098019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).