C31H35F6NO5 — CID 19098235
3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-[cyclohexyl(phenyl)methyl]-1-azabicyclo[2.2.2]octane;oxalic acid (PubChem CID 19098235) has the molecular formula C31H35F6NO5 and a molecular weight of 615.61 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-[cyclohexyl(phenyl)methyl]-1-azabicyclo[2.2.2]octane;oxalic acid.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-[cyclohexyl(phenyl)methyl]-1-azabicyclo[2.2.2]octane;oxalic acid |
|---|---|
| PubChem CID | 19098235 |
| Molecular Formula | C31H35F6NO5 |
| Molecular Weight | 615.61 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-[cyclohexyl(phenyl)methyl]-1-azabicyclo[2.2.2]octane;oxalic acid |
| SMILES | FC(F)(F)c1cc(COC2C3CCN(CC3)C2C(c2ccccc2)C2CCCCC2)cc(C(F)(F)F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H33F6NO.C2H2O4/c30-28(31,32)23-15-19(16-24(17-23)29(33,34)35)18-37-27-22-11-13-36(14-12-22)26(27)25(20-7-3-1-4-8-20)21-9-5-2-6-10-21;3-1(4)2(5)6/h1,3-4,7-8,15-17,21-22,25-27H,2,5-6,9-14,18H2;(H,3,4)(H,5,6) |
| InChIKey | OKXOSVFTTOJUIA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.61 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|