C23H27NO3S — CID 19098414
6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-benzoxathiin-2-one (PubChem CID 19098414) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is 6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-benzoxathiin-2-one.
| Compound Name | 6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-benzoxathiin-2-one |
|---|---|
| PubChem CID | 19098414 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 6-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-benzoxathiin-2-one |
| SMILES | COc1cccc2c1CCCC2CN(C)CCc1ccc2c(c1)SCC(=O)O2 |
| InChI | InChI=1S/C23H27NO3S/c1-24(12-11-16-9-10-21-22(13-16)28-15-23(25)27-21)14-17-5-3-7-19-18(17)6-4-8-20(19)26-2/h4,6,8-10,13,17H,3,5,7,11-12,14-15H2,1-2H3 |
| InChIKey | ULPAVSLHZUTQLL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|