About 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid
2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid (PubChem CID 19098421) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid |
| PubChem CID | 19098421 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)COC2 |
| InChI | InChI=1S/C10H10O3/c11-10(12)4-7-1-2-8-5-13-6-9(8)3-7/h1-3H,4-6H2,(H,11,12) |
| InChIKey | LBKSMTNZFNZDPQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid?
The IUPAC name of 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid (CID 19098421) is 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid.
What is the SMILES notation for 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid?
The canonical SMILES for 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid is O=C(O)Cc1ccc2c(c1)COC2.
What is the InChIKey of 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid?
The InChIKey is LBKSMTNZFNZDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-10(12)4-7-1-2-8-5-13-6-9(8)3-7/h1-3H,4-6H2,(H,11,12).
What are the key properties of 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid?
2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid has a molecular weight of 178.19 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydro-2-benzofuran-5-yl)acetic acid is sourced from PubChem (CID 19098421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).