C23H28N2O3 — CID 19098585
7-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-dihydro-2,1-benzoxazin-3-one (PubChem CID 19098585) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 7-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-dihydro-2,1-benzoxazin-3-one.
| Compound Name | 7-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-dihydro-2,1-benzoxazin-3-one |
|---|---|
| PubChem CID | 19098585 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 7-[2-[(5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-methylamino]ethyl]-1,4-dihydro-2,1-benzoxazin-3-one |
| SMILES | COc1cccc2c1CCCC2CN(C)CCc1ccc2c(c1)NOC(=O)C2 |
| InChI | InChI=1S/C23H28N2O3/c1-25(12-11-16-9-10-17-14-23(26)28-24-21(17)13-16)15-18-5-3-7-20-19(18)6-4-8-22(20)27-2/h4,6,8-10,13,18,24H,3,5,7,11-12,14-15H2,1-2H3 |
| InChIKey | BJSKGRHZFYVRKN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |