C9H11Cl3 — CID 19098758
1,3,5-trichloro-2,3,6-trimethylcyclohexa-1,4-diene (PubChem CID 19098758) has the molecular formula C9H11Cl3 and a molecular weight of 225.55 g/mol. Its IUPAC name is 1,3,5-trichloro-2,3,6-trimethylcyclohexa-1,4-diene.
| Compound Name | 1,3,5-trichloro-2,3,6-trimethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 19098758 |
| Molecular Formula | C9H11Cl3 |
| Molecular Weight | 225.55 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 1,3,5-trichloro-2,3,6-trimethylcyclohexa-1,4-diene |
| SMILES | CC1=C(Cl)C(C)C(Cl)=CC1(C)Cl |
| InChI | InChI=1S/C9H11Cl3/c1-5-7(10)4-9(3,12)6(2)8(5)11/h4-5H,1-3H3 |
| InChIKey | JQJPOQFOONLUEP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|