C10H14Cl2 — CID 19098761
1,3-dichloro-2,3,5,6-tetramethylcyclohexa-1,4-diene (PubChem CID 19098761) has the molecular formula C10H14Cl2 and a molecular weight of 205.13 g/mol. Its IUPAC name is 1,3-dichloro-2,3,5,6-tetramethylcyclohexa-1,4-diene.
| Compound Name | 1,3-dichloro-2,3,5,6-tetramethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 19098761 |
| Molecular Formula | C10H14Cl2 |
| Molecular Weight | 205.13 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1,3-dichloro-2,3,5,6-tetramethylcyclohexa-1,4-diene |
| SMILES | CC1=CC(C)(Cl)C(C)=C(Cl)C1C |
| InChI | InChI=1S/C10H14Cl2/c1-6-5-10(4,12)8(3)9(11)7(6)2/h5,7H,1-4H3 |
| InChIKey | JODFSHKKYFFEAD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|