About benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol
benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol (PubChem CID 19098797) has the molecular formula C20H17N3O3S
and a molecular weight of 379.44 g/mol. Its IUPAC name is benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol.
Molecular Properties
| Compound Name | benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol |
| PubChem CID | 19098797 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol |
| SMILES | O=C(O)c1ccccc1.Oc1ccccc1CSc1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C13H11N3OS.C7H6O2/c17-12-4-2-1-3-9(12)8-18-13-15-10-5-6-14-7-11(10)16-13;8-7(9)6-4-2-1-3-5-6/h1-7,17H,8H2,(H,15,16);1-5H,(H,8,9) |
| InChIKey | XCRCSGCNMILXIS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol?
The IUPAC name of benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol (CID 19098797) is benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol.
What is the SMILES notation for benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol?
The canonical SMILES for benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol is O=C(O)c1ccccc1.Oc1ccccc1CSc1nc2ccncc2[nH]1.
What is the InChIKey of benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol?
The InChIKey is XCRCSGCNMILXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3OS.C7H6O2/c17-12-4-2-1-3-9(12)8-18-13-15-10-5-6-14-7-11(10)16-13;8-7(9)6-4-2-1-3-5-6/h1-7,17H,8H2,(H,15,16);1-5H,(H,8,9).
What are the key properties of benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol?
benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol has a molecular weight of 379.44 g/mol, XLogP of 4.34, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-(3H-imidazo[4,5-c]pyridin-2-ylsulfanylmethyl)phenol is sourced from PubChem (CID 19098797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).