About 1-aminopentan-1-ol
1-aminopentan-1-ol (PubChem CID 19098916) has the molecular formula C5H13NO
and a molecular weight of 103.16 g/mol. Its IUPAC name is 1-aminopentan-1-ol.
Molecular Properties
| Compound Name | 1-aminopentan-1-ol |
| PubChem CID | 19098916 |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | 1-aminopentan-1-ol |
| SMILES | CCCCC(N)O |
| InChI | InChI=1S/C5H13NO/c1-2-3-4-5(6)7/h5,7H,2-4,6H2,1H3 |
| InChIKey | WGAOZGUUHIBABN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopentan-1-ol?
The IUPAC name of 1-aminopentan-1-ol (CID 19098916) is 1-aminopentan-1-ol.
What is the SMILES notation for 1-aminopentan-1-ol?
The canonical SMILES for 1-aminopentan-1-ol is CCCCC(N)O.
What is the InChIKey of 1-aminopentan-1-ol?
The InChIKey is WGAOZGUUHIBABN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO/c1-2-3-4-5(6)7/h5,7H,2-4,6H2,1H3.
What are the key properties of 1-aminopentan-1-ol?
1-aminopentan-1-ol has a molecular weight of 103.16 g/mol, XLogP of 0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopentan-1-ol is sourced from PubChem (CID 19098916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).