C13H16F10O4 — CID 19099131
propan-2-yl 2-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-2-propan-2-yloxypropanoate (PubChem CID 19099131) has the molecular formula C13H16F10O4 and a molecular weight of 426.25 g/mol. Its IUPAC name is propan-2-yl 2-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-2-propan-2-yloxypropanoate.
| Compound Name | propan-2-yl 2-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-2-propan-2-yloxypropanoate |
|---|---|
| PubChem CID | 19099131 |
| Molecular Formula | C13H16F10O4 |
| Molecular Weight | 426.25 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | propan-2-yl 2-fluoro-3-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)-2-propan-2-yloxypropanoate |
| SMILES | CC(C)OC(=O)C(F)(COC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(C)C |
| InChI | InChI=1S/C13H16F10O4/c1-6(2)26-8(24)9(14,27-7(3)4)5-25-13(22,23)11(17,18)10(15,16)12(19,20)21/h6-7H,5H2,1-4H3 |
| InChIKey | ANLQNAWYMXIBSW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|