C7F14O — CID 19099136
2,2,3,3,4,4,5-heptafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxolane (PubChem CID 19099136) has the molecular formula C7F14O and a molecular weight of 366.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxolane.
| Compound Name | 2,2,3,3,4,4,5-heptafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxolane |
|---|---|
| PubChem CID | 19099136 |
| Molecular Formula | C7F14O |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoro-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)oxolane |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7F14O/c8-1(5(14,15)16,6(17,18)19)4(13)2(9,10)3(11,12)7(20,21)22-4 |
| InChIKey | KNOQJUXIRVULFH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|