C11H21O3Si- — CID 19099242
3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate (PubChem CID 19099242) has the molecular formula C11H21O3Si- and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 19099242 |
| Molecular Formula | C11H21O3Si- |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)[O-])C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22O3Si/c1-8(10(12)13)9(2)14-15(6,7)11(3,4)5/h9H,1H2,2-7H3,(H,12,13)/p-1 |
| InChIKey | UUFKYBAJIZRFQO-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|