About 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine
2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine (PubChem CID 19099352) has the molecular formula C19H20N2S
and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine.
Molecular Properties
| Compound Name | 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine |
| PubChem CID | 19099352 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine |
| SMILES | Cc1cc2c(s1)Cc1ccccc1N=C2C1=CCCN(C)C1 |
| InChI | InChI=1S/C19H20N2S/c1-13-10-16-18(22-13)11-14-6-3-4-8-17(14)20-19(16)15-7-5-9-21(2)12-15/h3-4,6-8,10H,5,9,11-12H2,1-2H3 |
| InChIKey | NFHNAZPYPDMLGR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine?
The IUPAC name of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine (CID 19099352) is 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine.
What is the SMILES notation for 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine?
The canonical SMILES for 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine is Cc1cc2c(s1)Cc1ccccc1N=C2C1=CCCN(C)C1.
What is the InChIKey of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine?
The InChIKey is NFHNAZPYPDMLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2S/c1-13-10-16-18(22-13)11-14-6-3-4-8-17(14)20-19(16)15-7-5-9-21(2)12-15/h3-4,6-8,10H,5,9,11-12H2,1-2H3.
What are the key properties of 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine?
2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine has a molecular weight of 308.45 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-10H-thieno[3,2-c][1]benzazepine is sourced from PubChem (CID 19099352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).