About 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine
8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine (PubChem CID 19099358) has the molecular formula C19H17ClN2S
and a molecular weight of 340.88 g/mol. Its IUPAC name is 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
| PubChem CID | 19099358 |
| Molecular Formula | C19H17ClN2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CN1CCC=C(C2=Nc3ccccc3Sc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C19H17ClN2S/c1-22-10-4-5-13(12-22)19-15-11-14(20)8-9-17(15)23-18-7-3-2-6-16(18)21-19/h2-3,5-9,11H,4,10,12H2,1H3 |
| InChIKey | LWLBDYOHWLJKOA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
The IUPAC name of 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine (CID 19099358) is 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine.
What is the SMILES notation for 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
The canonical SMILES for 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine is CN1CCC=C(C2=Nc3ccccc3Sc3ccc(Cl)cc32)C1.
What is the InChIKey of 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
The InChIKey is LWLBDYOHWLJKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2S/c1-22-10-4-5-13(12-22)19-15-11-14(20)8-9-17(15)23-18-7-3-2-6-16(18)21-19/h2-3,5-9,11H,4,10,12H2,1H3.
What are the key properties of 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine has a molecular weight of 340.88 g/mol, XLogP of 5.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine is sourced from PubChem (CID 19099358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).