About 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine
8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine (PubChem CID 19099364) has the molecular formula C21H22N2S
and a molecular weight of 334.49 g/mol. Its IUPAC name is 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
| PubChem CID | 19099364 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine |
| SMILES | CCc1ccc2c(c1)C(C1=CCCN(C)C1)=Nc1ccccc1S2 |
| InChI | InChI=1S/C21H22N2S/c1-3-15-10-11-19-17(13-15)21(16-7-6-12-23(2)14-16)22-18-8-4-5-9-20(18)24-19/h4-5,7-11,13H,3,6,12,14H2,1-2H3 |
| InChIKey | QDPXYEBPUVZNOH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
The IUPAC name of 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine (CID 19099364) is 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine.
What is the SMILES notation for 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
The canonical SMILES for 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine is CCc1ccc2c(c1)C(C1=CCCN(C)C1)=Nc1ccccc1S2.
What is the InChIKey of 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
The InChIKey is QDPXYEBPUVZNOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2S/c1-3-15-10-11-19-17(13-15)21(16-7-6-12-23(2)14-16)22-18-8-4-5-9-20(18)24-19/h4-5,7-11,13H,3,6,12,14H2,1-2H3.
What are the key properties of 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine?
8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine has a molecular weight of 334.49 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-6-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)benzo[b][1,4]benzothiazepine is sourced from PubChem (CID 19099364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).