About (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride
(2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride (PubChem CID 19099414) has the molecular formula C8H14ClF2N
and a molecular weight of 197.66 g/mol. Its IUPAC name is (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride.
Molecular Properties
| Compound Name | (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride |
| PubChem CID | 19099414 |
| Molecular Formula | C8H14ClF2N |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride |
| SMILES | C=CCC(F)(F)C(N)/C=C/C.Cl |
| InChI | InChI=1S/C8H13F2N.ClH/c1-3-5-7(11)8(9,10)6-4-2;/h3-5,7H,2,6,11H2,1H3;1H/b5-3+; |
| InChIKey | HCTWQULDJFBPDF-WGCWOXMQSA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride?
The IUPAC name of (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride (CID 19099414) is (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride.
What is the SMILES notation for (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride?
The canonical SMILES for (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride is C=CCC(F)(F)C(N)/C=C/C.Cl.
What is the InChIKey of (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride?
The InChIKey is HCTWQULDJFBPDF-WGCWOXMQSA-N. The full InChI is InChI=1S/C8H13F2N.ClH/c1-3-5-7(11)8(9,10)6-4-2;/h3-5,7H,2,6,11H2,1H3;1H/b5-3+;.
What are the key properties of (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride?
(2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride has a molecular weight of 197.66 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5,5-difluoroocta-2,7-dien-4-amine;hydrochloride is sourced from PubChem (CID 19099414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).