About 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride
1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride (PubChem CID 19099566) has the molecular formula C18H34ClNO
and a molecular weight of 315.93 g/mol. Its IUPAC name is 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride |
| PubChem CID | 19099566 |
| Molecular Formula | C18H34ClNO |
| Molecular Weight | 315.93 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride |
| SMILES | CC1CCNC(C)C1(C)CCC(=O)CCC1CCCC1.Cl |
| InChI | InChI=1S/C18H33NO.ClH/c1-14-11-13-19-15(2)18(14,3)12-10-17(20)9-8-16-6-4-5-7-16;/h14-16,19H,4-13H2,1-3H3;1H |
| InChIKey | OHHSJGOWMKUETD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride?
The IUPAC name of 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride (CID 19099566) is 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride.
What is the SMILES notation for 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride?
The canonical SMILES for 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride is CC1CCNC(C)C1(C)CCC(=O)CCC1CCCC1.Cl.
What is the InChIKey of 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride?
The InChIKey is OHHSJGOWMKUETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO.ClH/c1-14-11-13-19-15(2)18(14,3)12-10-17(20)9-8-16-6-4-5-7-16;/h14-16,19H,4-13H2,1-3H3;1H.
What are the key properties of 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride?
1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride has a molecular weight of 315.93 g/mol, XLogP of 4.75, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-5-(2,3,4-trimethylpiperidin-3-yl)pentan-3-one;hydrochloride is sourced from PubChem (CID 19099566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).